Loading distributor info...
| Description | TM5441 is an orally bioavailable inhibitor of plasminogen activator inhibitor-1 (PAI-1), has IC50 values between 13.9 and 51.1 μM and induces intrinsic apoptosis in several human cancer cell lines. |
|---|
| Catalog Num | A19369 |
|---|---|
| Formula | C21H17ClN2O6 |
| Molecular Weight | 428.82 |
| CAS Number | 1190221-43-2 |
| SMILES | ClC1=CC=C(NC(COCC(NC2=CC=CC(C3=COC=C3)=C2)=O)=O)C(C(O)=O)=C1 |
| Synonyms | M-5441; TM 5441; BMS-790052; BMS-790052; BMS790052; EBP 883; EBP-883; EBP883 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 83 mg/mL (193.55 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.32 mL | 116.6 mL | 233.2 mL |
| 0.5 mM | 4.66 mL | 23.32 mL | 46.64 mL |
| 1 mM | 2.33 mL | 11.66 mL | 23.32 mL |
| 5 mM | 0.47 mL | 2.33 mL | 4.66 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
