Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Topotecan HCl (Hycamtin) is a chemotherapeutic agent that is a topoisomerase inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10939 |
|---|---|
| Formula | C23H23N3O5 .HCl |
| Molecular Weight | 457.9 |
| CAS Number | 119413-54-6 |
| SMILES | CC[C@@]1(C2=C(COC1=O)C(=O)N3CC4=C(C3=C2)N=C5C=CC(=C(C5=C4)CN(C)C)O)O.Cl |
| Synonyms | Hycamtin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 87 mg/mL (189.99 mM) | |
| Water | 87 mg/mL (189.99 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | Saline | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.84 mL | 109.19 mL | 218.39 mL |
| 0.5 mM | 4.37 mL | 21.84 mL | 43.68 mL |
| 1 mM | 2.18 mL | 10.92 mL | 21.84 mL |
| 5 mM | 0.44 mL | 2.18 mL | 4.37 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
