Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Treprostinil sodium is a potent DP1 and EP2 agonist with EC50 values of 0.6??0.1 and 6.2??1.2 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21046 |
|---|---|
| Formula | C23H33NaO5 |
| Molecular Weight | 412.49 |
| CAS Number | 289480-64-4 |
| SMILES | O=C([O-])COC1=C2C[C@@]3([H])C[C@@H](O)[C@H](CC[C@@H](O)CCCCC)[C@@]3([H])CC2=CC=C1.[Na+] |
| Synonyms | UT-15, UT15, UT 15 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (181.82 mM) | |
| Water | 75 mg/mL (181.82 mM) | ||
| Ethanol | 75 mg/mL (181.82 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.24 mL | 121.22 mL | 242.43 mL |
| 0.5 mM | 4.85 mL | 24.24 mL | 48.49 mL |
| 1 mM | 2.42 mL | 12.12 mL | 24.24 mL |
| 5 mM | 0.48 mL | 2.42 mL | 4.85 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
