Loading distributor info...
| Description | Trimebutine Maleate is a drug with antimuscarinic and weak mu opioid agonist effects. Trimebutine Maleate modulates the calcium and potassium channels, relieves abdominal pain in patients with irritable bowel syndrome. |
|---|
| Catalog Num | A18115 |
|---|---|
| Formula | C26H33NO9 |
| Molecular Weight | 503.55 |
| CAS Number | 34140-59-5 |
| SMILES | O=C(OCC(C1=CC=CC=C1)(N(C)C)CC)C2=CC(OC)=C(OC)C(OC)=C2.O=C(O)/C=C\C(O)=O |
| Synonyms | Trimebutine Maleate; Debridat; Polibutin; Modulon; Dromostat; EINECS 251-845-9; Ibutin; Polibutin; TM 906; Trimebutine maleate, Trimedat |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (168.8 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.86 mL | 99.3 mL | 198.59 mL |
| 0.5 mM | 3.97 mL | 19.86 mL | 39.72 mL |
| 1 mM | 1.99 mL | 9.93 mL | 19.86 mL |
| 5 mM | 0.4 mL | 1.99 mL | 3.97 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
