Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | URMC-099 is an orally bioavailable, brain penetrant mixed lineage kinase (MLK) inhibitor with IC50 of 19 nM, 42 nM, 14 nM, and 150 nM, for MLK1, MLK2, MLK3, and DLK, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14219 |
|---|---|
| Formula | C27H27N5 |
| Molecular Weight | 421.54 |
| CAS Number | 1229582-33-5 |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)C3=CN=C4C(=C3)C(=CN4)C5=CC6=C(C=C5)NC=C6 |
| Synonyms | URMC 099,URMC099 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (180.28 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (11.86 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.72 mL | 118.61 mL | 237.23 mL |
| 0.5 mM | 4.74 mL | 23.72 mL | 47.45 mL |
| 1 mM | 2.37 mL | 11.86 mL | 23.72 mL |
| 5 mM | 0.47 mL | 2.37 mL | 4.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
