Total item
Cart Subtotal
$0.00 Biological Activity
URMC-099 is an orally bioavailable, brain penetrant mixed lineage kinase (MLK) inhibitor with IC50 of 19 nM, 42 nM, 14 nM, and 150 nM, for MLK1, MLK2, MLK3, and DLK, respectively.
Targets
| Target | Value |
|---|---|
| Abl1 | IC50: 6.5nM |
| LRRK2 | IC50: 11nM |
| MLK3 | IC50: 14nM |
| MLK1 | IC50: 19nM |
| VEGFR1/FLT1 | IC50: 39nM |
| MLK2 | IC50: 42nM |
| SGK | IC50: 67nM |
| TrkA | IC50: 85nM |
| AuroraA | IC50: 108nM |
| ROCK2 | IC50: 111nM |
| AuroraB | IC50: 123nM |
| DLK | IC50: 150nM |
| c-Met | IC50: 177nM |
| IR | IC50: 200nM |
| SGK1 | IC50: 201nM |
| TrkB | IC50: 217nM |
| AuroraC | IC50: 290nM |
| IGF-1R | IC50: 307nM |
| LCK | IC50: 333nM |
| MEKK2 | IC50: 661nM |
| Syk | IC50: 731nM |
| ROCK1 | IC50: 1030nM |
| CDK1 | IC50: 1125nM |
| CDK2 | IC50: 1180nM |
| AMPK | IC50: 1512nM |
| JNK1 | IC50: 3280nM |
| Src | IC50: 4330nM |
| ZAP70 | IC50: 5050nM |
| ERK2 | IC50: 6290nM |
| GSK-3β | IC50: >10000nM |
| p38α | IC50: 12050nM |
| In vitro | DMSO | 84 mg/mL (199.26 mM) | |
| Water | <1 mg/mL (<1 mM) | ||
| Ethanol | 84 mg/mL (199.26 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.72 mL | 118.61 mL | 237.23 mL |
| 0.5 mM | 4.74 mL | 23.72 mL | 47.45 mL |
| 1 mM | 2.37 mL | 11.86 mL | 23.72 mL |
| 5 mM | 0.47 mL | 2.37 mL | 4.74 mL |
*The above data is based on the productmolecular weight 421.54. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
| Catalog Num | A14219 |
|---|---|
| Actions | Inhibitor |
| M. Wt | 421.54 |
| Formula | C27H27N5 |
| Solubility | DMSO |
| Purity | >98% |
| Storage | at -20°C 3 years Powder |
| CAS No. | 1229582-33-5 |
| Synonyms | URMC 099,URMC099 |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)C3=CN=C4C(=C3)C(=CN4)C5=CC6=C(C=C5)NC=C6 |
Product Tags
Product Questions
Product Questions
No Questions
Keywords:buy URMC-099 | URMC-099 Supplier | purchase URMC-099 | URMC-099 cost | URMC-099 manufacturer | order URMC-099 | URMC-099 distributor | buy 1229582-33-5| 1229582-33-5 Supplier | purchase 1229582-33-5 | 1229582-33-5 cost | 1229582-33-5 manufacturer | order 1229582-33-5 | 1229582-33-5 distributor
Contact information
United StatesAdooq Bioscience
Toll Free: (866) 930-6790
Fax: +1-323-606-8156
Email: [email protected]
Not your Region? View all Distributors
Adooq Quality Guarantee
We promise all products perform as described.