Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Vanillylacetone is similar in chemical structure to other flavor chemicals such as vanillin and eugenol. It is used as a flavor additive in spice oils and in perfumery to introduce spicy aromas. |
|---|
| Catalog Num | A10964 |
|---|---|
| Formula | C11H14O3 |
| Molecular Weight | 194.2 |
| CAS Number | 122-48-5 |
| SMILES | CC(=O)CCC1=CC(=C(C=C1)O)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 36 mg/mL (185.34 mM) | |
| Water | Warmed: 10 mg/mL (51.48 mM) | ||
| Ethanol | 36 mg/mL (185.34 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 51.49 mL | 257.47 mL | 514.93 mL |
| 0.5 mM | 10.3 mL | 51.49 mL | 102.99 mL |
| 1 mM | 5.15 mL | 25.75 mL | 51.49 mL |
| 5 mM | 1.03 mL | 5.15 mL | 10.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
