Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | VLX1570 is a competitive inhibitor of proteasome DUB activity, with an IC50 of ~10?μM in vitro. |
|---|
| Catalog Num | A16853 |
|---|---|
| Formula | C23H17F2N3O6 |
| Molecular Weight | 469.39 |
| CAS Number | 1431280-51-1 |
| SMILES | O=C1/C(CN(C(C=C)=O)CC/C1=C/C2=CC=C(F)C([N+]([O-])=O)=C2)=C\C3=CC=C(F)C([N+]([O-])=O)=C3 |
| Synonyms | VLX 1570, VLX-1570 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (168.3 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.3 mL | 106.52 mL | 213.04 mL |
| 0.5 mM | 4.26 mL | 21.3 mL | 42.61 mL |
| 1 mM | 2.13 mL | 10.65 mL | 21.3 mL |
| 5 mM | 0.43 mL | 2.13 mL | 4.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
