Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | VS-5584 is a novel and highly selective PI3K/mTOR kinase inhibitor for the treatment of cancer. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12480 |
|---|---|
| Formula | C17H22N8O |
| Molecular Weight | 354.41 |
| CAS Number | 1246560-33-7 |
| SMILES | CC1=NC2=C(N=C(N=C2N1C(C)C)N3CCOCC3)C4=CN=C(N=C4)N |
| Synonyms | SB2343, VS5584, SB-2343, SB 2343 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 70 mg/mL (197.51 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (8.46 mM) | ||
| In vivo | 0.5% methylcellulose+0.2% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.22 mL | 141.08 mL | 282.16 mL |
| 0.5 mM | 5.64 mL | 28.22 mL | 56.43 mL |
| 1 mM | 2.82 mL | 14.11 mL | 28.22 mL |
| 5 mM | 0.56 mL | 2.82 mL | 5.64 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
