Loading distributor info...
| Description | VU 0364770 is a positive allosteric modulator at mGlu4 receptors with EC50 value of 290 nM in mGlu4-expressing HEK 293 cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12139 |
|---|---|
| Formula | C12H9ClN2O |
| Molecular Weight | 232.67 |
| CAS Number | 61350-00-3 |
| SMILES | C1=CC=NC(=C1)C(=O)NC2=CC(=CC=C2)Cl |
| Synonyms | VU0364770 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 46 mg/mL (197.7 mM) | |
| Water | Insoluble | ||
| Ethanol | 46 mg/mL (197.7 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.98 mL | 214.9 mL | 429.79 mL |
| 0.5 mM | 8.6 mL | 42.98 mL | 85.96 mL |
| 1 mM | 4.3 mL | 21.49 mL | 42.98 mL |
| 5 mM | 0.86 mL | 4.3 mL | 8.6 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
