Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | VX-680 is a potent and selective small-molecule inhibitor of the Aurora kinases. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10981 |
|---|---|
| Formula | C23H28N8OS |
| Molecular Weight | 464.6 |
| CAS Number | 639089-54-6 |
| SMILES | CC1=CC(=NN1)NC2=NC(=NC(=C2)N3CCN(CC3)C)SC4=CC=C(C=C4)NC(=O)C5CC5 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 90 mg/mL (193.71 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+30% PEG 300+2% Tween 80+ddH2O | 14 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.52 mL | 107.62 mL | 215.24 mL |
| 0.5 mM | 4.3 mL | 21.52 mL | 43.05 mL |
| 1 mM | 2.15 mL | 10.76 mL | 21.52 mL |
| 5 mM | 0.43 mL | 2.15 mL | 4.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
