Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | WZ4003 is a highly specific NUAK kinase inhibitor with IC50 of 20 nM and 100 nM for NUAK1 and NUAK2 | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14312 |
|---|---|
| Formula | C25H29ClN6O3 |
| Molecular Weight | 496.99 |
| CAS Number | 1214265-58-3 |
| SMILES | CCC(=O)NC1=CC(=CC=C1)OC2=NC(=NC=C2Cl)NC3=C(C=C(C=C3)N4CCN(CC4)C)OC |
| Synonyms | WZ 4003, WZ-4003 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (14.08 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.12 mL | 100.61 mL | 201.21 mL |
| 0.5 mM | 4.02 mL | 20.12 mL | 40.24 mL |
| 1 mM | 2.01 mL | 10.06 mL | 20.12 mL |
| 5 mM | 0.4 mL | 2.01 mL | 4.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
