Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Xanthopterin hydrate, an unconjugated pteridine compound, is the main component of the yellow granule in the Oriental hornet bear wings, produces a characteristic excitation/emission maximum at 386/456 nm. |
|---|
| Catalog Num | A18003 |
|---|---|
| Formula | C6H7N5O3 |
| Molecular Weight | 197.15 |
| CAS Number | CAS: 5979-01-1 |
| SMILES | O=C1NC(N)=NC2=C1NC(C=N2)=O.O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 1 mg/mL (5.07 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 50.72 mL | 253.61 mL | 507.23 mL |
| 0.5 mM | 10.14 mL | 50.72 mL | 101.45 mL |
| 1 mM | 5.07 mL | 25.36 mL | 50.72 mL |
| 5 mM | 1.01 mL | 5.07 mL | 10.14 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
