Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ZM 39923 HCl is an inhibitor of JAK3 (IC50 = 79 nM) that less potently inhibits epidermal growth factor receptor, JAK1, and cyclin-dependent kinase 4 (IC50s = 2.4, 40, and 10 M, respectively) | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13509 |
|---|---|
| Formula | C23H25NOHCl |
| Molecular Weight | 367.9 |
| CAS Number | 1021868-92-7 |
| SMILES | O=C(CCN(CC1=CC=CC=C1)C(C)C)C2=CC3=CC=CC=C3C=C2.Cl |
| Synonyms | JAK3 Inhibitor IV |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 26 mg/mL (70.67 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL (19.02 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.18 mL | 135.91 mL | 271.81 mL |
| 0.5 mM | 5.44 mL | 27.18 mL | 54.36 mL |
| 1 mM | 2.72 mL | 13.59 mL | 27.18 mL |
| 5 mM | 0.54 mL | 2.72 mL | 5.44 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
