Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Alantolactone, an allergenic sesquiterpene lactone, has recently been found to have significant antitumor effects on malignant tumor cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14810 |
|---|---|
| Formula | C15H20O2 |
| Molecular Weight | 232.32 |
| CAS Number | 546-43-0 |
| SMILES | CC1CCCC2(C1=CC3C(C2)OC(=O)C3=C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 41 mg/mL (176.48 mM) | |
| Water | Insoluble | ||
| Ethanol | 41 mg/mL (176.48 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.04 mL | 215.22 mL | 430.44 mL |
| 0.5 mM | 8.61 mL | 43.04 mL | 86.09 mL |
| 1 mM | 4.3 mL | 21.52 mL | 43.04 mL |
| 5 mM | 0.86 mL | 4.3 mL | 8.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
