Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Amiodarone hydrochloride is an antiarrhythmic drug for inhibition of ATP-sensitive potassium channel with IC50 of 19.1 μM. |
|---|
| Catalog Num | A11798 |
|---|---|
| Formula | C25H30ClI2NO3 |
| Molecular Weight | 681.77 |
| CAS Number | 19774-82-4 |
| SMILES | CCCCC1=C(C(C2=CC(I)=C(OCCN(CC)CC)C(I)=C2)=O)C3=C(O1)C=CC=C3.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 22 mg/mL (32.26 mM) | |
| Water | Insoluble | ||
| Ethanol | 11 mg/mL (16.13 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.67 mL | 73.34 mL | 146.68 mL |
| 0.5 mM | 2.93 mL | 14.67 mL | 29.34 mL |
| 1 mM | 1.47 mL | 7.33 mL | 14.67 mL |
| 5 mM | 0.29 mL | 1.47 mL | 2.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
