Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Amorolfine hydrochloride, is a morpholine antifungal reagent that inhibits D14 reductase and D7-D8 isomerase, which depletes ergosterol and causes ignosterol to accumulate in the fungal cytoplasmic cell membranes. |
|---|
| Catalog Num | A10072 |
|---|---|
| Formula | C21H36ClNO |
| Molecular Weight | 354 |
| CAS Number | 78613-38-4 |
| SMILES | CCC(C)(C)C1=CC=C(C=C1)CC(C)CN2C[C@H](O[C@H](C2)C)C.Cl |
| Synonyms | Amorolfin, Curanail, Loceryl, Locetar, Odenil |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 25 mg/mL (70.63 mM) | |
| Water | 8 mg/mL (22.6 mM) | ||
| Ethanol | 64 mg/mL (180.8 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.25 mL | 141.24 mL | 282.49 mL |
| 0.5 mM | 5.65 mL | 28.25 mL | 56.5 mL |
| 1 mM | 2.82 mL | 14.12 mL | 28.25 mL |
| 5 mM | 0.56 mL | 2.82 mL | 5.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
