Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AT9283 inhibits aurora kinase A and B and targets other tyrosine and serine/threonine kinases associated with myeloid cell proliferation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10095 |
|---|---|
| Formula | C19H23N7O2 |
| Molecular Weight | 381.4 |
| CAS Number | 896466-04-9 |
| SMILES | C1CC1NC(=O)NC\2=CNN/C2=C\3/N=C4C=CC(=CC4=N3)CN5CCOCC5 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 68 mg/mL (178.28 mM) | |
| Water | Insoluble | ||
| Ethanol | 34 mg/mL (89.13 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.22 mL | 131.1 mL | 262.19 mL |
| 0.5 mM | 5.24 mL | 26.22 mL | 52.44 mL |
| 1 mM | 2.62 mL | 13.11 mL | 26.22 mL |
| 5 mM | 0.52 mL | 2.62 mL | 5.24 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
