Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD-5069 is a potent and selective CXCR2 antagonist with the potential to inhibit neutrophil migration into the airways in patients with COPD. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15941 |
|---|---|
| Formula | C18H22F2N4O5S2 |
| Molecular Weight | 476.51 |
| CAS Number | 878385-84-3 |
| SMILES | O=S(N1CCC1)(NC2=NC(SCC3=CC=CC(F)=C3F)=NC(O[C@H](C)[C@@H](O)CO)=C2)=O |
| Synonyms | AZD 5069, AZD5069 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (169.98 mM) | |
| Water | Insoluble | ||
| Ethanol | 6 mg/mL (12.58 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.99 mL | 104.93 mL | 209.86 mL |
| 0.5 mM | 4.2 mL | 20.99 mL | 41.97 mL |
| 1 mM | 2.1 mL | 10.49 mL | 20.99 mL |
| 5 mM | 0.42 mL | 2.1 mL | 4.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
