Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Bardoxolone methyl is an orally-available first-in-class synthetic triterpenoid. It is an inducer of the Nrf2 pathway, which can suppress oxidative stress and inflammation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11323 |
|---|---|
| Formula | C32H43NO4 |
| Molecular Weight | 505.7 |
| CAS Number | 218600-53-4 |
| SMILES | C[C@@]12CC[C@]3(CCC(C[C@H]3[C@H]1C(=O)C=C4[C@]2(CC[C@@H]5[C@@]4(C=C(C(=O)C5(C)C)C#N)C)C)(C)C)C(=O)OC |
| Synonyms | NSC 713200, CDDO-methyl ester |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 21 mg/mL (41.52 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4%DMSO+30% PEG300+5% Tween+61%ddH2O | 2.3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.77 mL | 98.87 mL | 197.75 mL |
| 0.5 mM | 3.95 mL | 19.77 mL | 39.55 mL |
| 1 mM | 1.98 mL | 9.89 mL | 19.77 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
