Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Bay 11-7821 is an irreversible inhibitor of TNF-α-stimulated IκBα phosphorylation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11957 |
|---|---|
| Formula | C10H9NO2S |
| Molecular Weight | 207.25 |
| CAS Number | 19542-67-7 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)/C=C/C#N |
| Synonyms | Bay-11-7821, Bay 117821, Bay117821,Bay 11-7082, Bay-11-7082, Bay11-7082 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 39 mg/mL (188.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 10 mg/mL (48.25 mM) | ||
| In vivo | 5% DMSO+corn oil | 7 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 48.25 mL | 241.25 mL | 482.51 mL |
| 0.5 mM | 9.65 mL | 48.25 mL | 96.5 mL |
| 1 mM | 4.83 mL | 24.13 mL | 48.25 mL |
| 5 mM | 0.97 mL | 4.83 mL | 9.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
