Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Brefeldin A blocks binding of ADP-ribosylation factor to the Golgi apparatus and inhibits GDP-GTP exchange. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11156 |
|---|---|
| Formula | C16H24O4 |
| Molecular Weight | 280.4 |
| CAS Number | 20350-15-6 |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@@H](C[C@H]2[C@@H](/C=C/C(=O)O1)O)O |
| Synonyms | Brefeldin-A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 4 mg/mL (14.26 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.66 mL | 178.32 mL | 356.63 mL |
| 0.5 mM | 7.13 mL | 35.66 mL | 71.33 mL |
| 1 mM | 3.57 mL | 17.83 mL | 35.66 mL |
| 5 mM | 0.71 mL | 3.57 mL | 7.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
