Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Butylated hydroxytoluene is di-tert-butyl PHENOL with antioxidant properties. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A17824 |
|---|---|
| Formula | C15H24O |
| Molecular Weight | 220.36 |
| CAS Number | 128-37-0 |
| SMILES | OC1=C(C(C)(C)C)C=C(C)C=C1C(C)(C)C |
| Synonyms | Butylated hydroxytoluene; NSC 6347; NSC-6347; NSC6347 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 39 mg/mL (176.99 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 45.38 mL | 226.9 mL | 453.8 mL |
| 0.5 mM | 9.08 mL | 45.38 mL | 90.76 mL |
| 1 mM | 4.54 mL | 22.69 mL | 45.38 mL |
| 5 mM | 0.91 mL | 4.54 mL | 9.08 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
