Loading distributor info...
| Description | Carbendazim is a broad-spectrum benzimidazole fungicide which can be used to control a broad range of diseases on arable crops, fruits, vegetables, ornamentals and medicinal herbs. |
|---|
| Catalog Num | A21261 |
|---|---|
| Formula | C9H9N3O2 |
| Molecular Weight | 191.19 |
| CAS Number | 10605-21-7 |
| SMILES | O=C(OC)NC1=NC2=CC=CC=C2N1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 15 mg/mL (78.45 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 52.3 mL | 261.52 mL | 523.04 mL |
| 0.5 mM | 10.46 mL | 52.3 mL | 104.61 mL |
| 1 mM | 5.23 mL | 26.15 mL | 52.3 mL |
| 5 mM | 1.05 mL | 5.23 mL | 10.46 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
