Signaling Pathway
CB-839 an is orally bioavailable inhibitor of glutaminase, with potential antineoplastic activity. CB-839 (Telaglenastat) also inudces autophagy and has antitumor activity.
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CB-839 an is orally bioavailable inhibitor of glutaminase, with potential antineoplastic activity. CB-839 (Telaglenastat) also inudces autophagy and has antitumor activity. |
||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14396 |
|---|---|
| Formula | C26H24F3N7O3S |
| Molecular Weight | 571.57 |
| CAS Number | 1439399-58-2 |
| SMILES | O=C(CC1=CC=CC(OC(F)(F)F)=C1)NC2=CC=C(CCCCC3=NN=C(NC(CC4=NC=CC=C4)=O)S3)N=N2 |
| Synonyms | CB839, CB 839 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 97 mg/mL (169.7 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+corn oil | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.5 mL | 87.48 mL | 174.96 mL |
| 0.5 mM | 3.5 mL | 17.5 mL | 34.99 mL |
| 1 mM | 1.75 mL | 8.75 mL | 17.5 mL |
| 5 mM | 0.35 mL | 1.75 mL | 3.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
