Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CBL0137 is a FACT inhibitor that functionally inactivates the facilitates chromatin transcription complex (FACT), driving the effects on p53 and NF-κB and promoting cancer cell death. |
|---|
| Catalog Num | A17143 |
|---|---|
| Formula | C21H24N2O2 |
| Molecular Weight | 336.43 |
| CAS Number | 1197996-80-7 |
| SMILES | CC(NCCN1C2=C(C3=C1C=CC(C(C)=O)=C3)C=C(C(C)=O)C=C2)C |
| Synonyms | CBL 0137, CBL-0137 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 14 mg/mL (41.61 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (23.77 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.72 mL | 148.62 mL | 297.24 mL |
| 0.5 mM | 5.94 mL | 29.72 mL | 59.45 mL |
| 1 mM | 2.97 mL | 14.86 mL | 29.72 mL |
| 5 mM | 0.59 mL | 2.97 mL | 5.94 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
