Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ceforanide is a semi-synthetic, broad-spectrum, beta-lactam, second-generation cephalosporin antibiotic with bactericidal activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17517 |
|---|---|
| Formula | C20H21N7O6S2 |
| Molecular Weight | 519.54 |
| CAS Number | 60925-61-3 |
| SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3CN)C(=O)O)CSC4=NN=NN4CC(=O)O |
| Synonyms | Ceforanide; Precef; Ceforanido; Ceforanidum; Ceforanidum; BL-S 786; BL-S786R; ceforanide, monosodium salt; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 6 mg/mL (11.54 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.25 mL | 96.24 mL | 192.48 mL |
| 0.5 mM | 3.85 mL | 19.25 mL | 38.5 mL |
| 1 mM | 1.92 mL | 9.62 mL | 19.25 mL |
| 5 mM | 0.38 mL | 1.92 mL | 3.85 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
