Signaling Pathway
CX-5461 is a first-in-class non-genotoxic small molecule targeted inhibitor of RNA polymerase I (Pol I) that activates the p53 pathway without causing DNA damage. It inhibits RNA polymerase I-driven transcription of rRNA with IC50s of 142, 113, and 54 nM in HCT-116, A375, and MIA PaCa-2 cells, respectively
Important Notice: For research use only. We do not sell to patients.
| Discription | CX-5461 is a first-in-class non-genotoxic small molecule targeted inhibitor of RNA polymerase I (Pol I) that activates the p53 pathway without causing DNA damage. It inhibits RNA polymerase I-driven transcription of rRNA with IC50s of 142, 113, and 54 nM in HCT-116, A375, and MIA PaCa-2 cells, respectively |
||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11065 |
|---|---|
| Formula | C27H27N7O2S |
| Molecular Weight | 513.6 |
| CAS Number | 1138549-36-6 |
| SMILES | CC1=CN=C(C=N1)CNC(=O)C2=C3N(C4=CC=CC=C4S3)C5=C(C2=O)C=CC(=N5)N6CCCN(CC6)C |
| Synonyms | CX5461 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | <1 mg/mL | |
| Water | Insoluble | ||
| Ethanol | DMF: Warmed: 3 mg/mL (5.84 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.47 mL | 97.35 mL | 194.7 mL |
| 0.5 mM | 3.89 mL | 19.47 mL | 38.94 mL |
| 1 mM | 1.95 mL | 9.74 mL | 19.47 mL |
| 5 mM | 0.39 mL | 1.95 mL | 3.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
