Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CX-6258 HCl is a potent, orally efficacious pan-Pim kinase inhibitor with IC50 of 5 nM, 25 nM and 16 nM for Pim1, Pim2, and Pim3. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14275 |
|---|---|
| Formula | C26H24ClN3O3.HCl |
| Molecular Weight | 498.4 |
| CAS Number | 1353859-00-3 |
| SMILES | CN1CCCN(CC1)C(=O)C2=CC=CC(=C2)C3=CC=C(O3)/C=C/4\C5=C(C=CC(=C5)Cl)NC4=O.Cl |
| Synonyms | CX6258 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 55 mg/mL (110.35 mM) | |
| Water | Warmed: 86 mg/mL (172.55 mM) | ||
| Ethanol | Warmed: 1 mg/mL (2 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.06 mL | 100.32 mL | 200.64 mL |
| 0.5 mM | 4.01 mL | 20.06 mL | 40.13 mL |
| 1 mM | 2.01 mL | 10.03 mL | 20.06 mL |
| 5 mM | 0.4 mL | 2.01 mL | 4.01 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
