Loading distributor info...
| Description | Disulfiram blocks the processing of alcohol in the body by inhibiting acetaldehyde dehydrogenase thus causing an unpleasant reaction when alcohol is consumed. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A10320 |
|---|---|
| Formula | C10H20N2S4 |
| Molecular Weight | 296.54 |
| CAS Number | 97-77-8 |
| SMILES | CCN(CC)C(=S)SSC(=S)N(CC)CC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 58 mg/mL (195.59 mM) | |
| Water | Insoluble | ||
| Ethanol | 58 mg/mL | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 2.3 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.72 mL | 168.61 mL | 337.22 mL |
| 0.5 mM | 6.74 mL | 33.72 mL | 67.44 mL |
| 1 mM | 3.37 mL | 16.86 mL | 33.72 mL |
| 5 mM | 0.67 mL | 3.37 mL | 6.74 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
