Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Docetaxel (Taxotere) is an antineoplastic agent that acts by disrupting the microtubular network in cells that is essential for mitotic and interphase cellular functions. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10326 |
|---|---|
| Formula | C43H53NO14 |
| Molecular Weight | 807.9 |
| CAS Number | 114977-28-5 |
| SMILES | CC1=C2[C@H](C(=O)[C@@]3([C@H](C[C@@H]4[C@]([C@H]3[C@@H]([C@@](C2(C)C)(C[C@@H]1OC(=O)[C@@H]([C@H](C5=CC=CC=C5)NC(=O)OC(C)(C)C)O)O)OC(=O)C6=CC=CC=C6)(CO4)OC(=O)C)O)C)O |
| Synonyms | Taxotere |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 92 mg/mL (113.88 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 49 mg/mL (60.65 mM) | ||
| In vivo | 5% DMSO+30% PEG 300+5% Tween 80+ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 12.38 mL | 61.89 mL | 123.78 mL |
| 0.5 mM | 2.48 mL | 12.38 mL | 24.76 mL |
| 1 mM | 1.24 mL | 6.19 mL | 12.38 mL |
| 5 mM | 0.25 mL | 1.24 mL | 2.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
