Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Droxinostat is a selective inhibitor of HDAC3, HDAC6, and HDAC8 that shows comparable inhibition of HDAC6 and HDAC8 with IC50 = 2.47 and 1.46 μmol/L, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10337 |
|---|---|
| Formula | C11H14ClNO3 |
| Molecular Weight | 243.7 |
| CAS Number | 99873-43-5 |
| SMILES | CC1=C(C=CC(=C1)Cl)OCCCC(=O)NO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 47 mg/mL (192.86 mM) | |
| Water | Insoluble | ||
| Ethanol | 47 mg/mL (192.86 mM) | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.03 mL | 205.17 mL | 410.34 mL |
| 0.5 mM | 8.21 mL | 41.03 mL | 82.07 mL |
| 1 mM | 4.1 mL | 20.52 mL | 41.03 mL |
| 5 mM | 0.82 mL | 4.1 mL | 8.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
