Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dutasteride is a dual 5-a reductase inhibitor that inhibits conversion of testosterone to dihydrotestosterone (DHT). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10338 |
|---|---|
| Formula | C27H30F6N2O2 |
| Molecular Weight | 528.5 |
| CAS Number | 164656-23-9 |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)NC4=C(C=CC(=C4)C(F)(F)F)C(F)(F)F)CC[C@@H]5[C@@]3(C=CC(=O)N5)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 57 mg/mL (107.84 mM) | |
| Water | Insoluble | ||
| Ethanol | 6 mg/mL (11.35 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.92 mL | 94.61 mL | 189.21 mL |
| 0.5 mM | 3.78 mL | 18.92 mL | 37.84 mL |
| 1 mM | 1.89 mL | 9.46 mL | 18.92 mL |
| 5 mM | 0.38 mL | 1.89 mL | 3.78 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
