Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | E-64d is an inhibitor of cathepsins B and L and it is lysosome and cell permeable. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13259 |
|---|---|
| Formula | C17H30N2O5 |
| Molecular Weight | 342.43 |
| CAS Number | 88321-09-9 |
| SMILES | CCOC(=O)[C@@H]1[C@H](O1)C(=O)N[C@@H](CC(C)C)C(=O)NCCC(C)C |
| Synonyms | E-64d, E64d |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 67 mg/mL (195.66 mM) | |
| Water | Insoluble | ||
| Ethanol | 67 mg/mL | ||
| In vivo | 2% DMSO+corn oil | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.2 mL | 146.02 mL | 292.03 mL |
| 0.5 mM | 5.84 mL | 29.2 mL | 58.41 mL |
| 1 mM | 2.92 mL | 14.6 mL | 29.2 mL |
| 5 mM | 0.58 mL | 2.92 mL | 5.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
