Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Elacridaris a prototypical BCRP inhibitor which inhibits the Bcrp1-mediated transport. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12324 |
|---|---|
| Formula | C34H33N3O5 |
| Molecular Weight | 563.64 |
| CAS Number | 143664-11-3 |
| SMILES | COC1=CC=CC2=C1NC3=C(C2=O)C=CC=C3C(=O)NC4=CC=C(C=C4)CCN5CCC6=CC(=C(C=C6C5)OC)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 7 mg/mL (12.42 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 300+5% Tween 80+ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.74 mL | 88.71 mL | 177.42 mL |
| 0.5 mM | 3.55 mL | 17.74 mL | 35.48 mL |
| 1 mM | 1.77 mL | 8.87 mL | 17.74 mL |
| 5 mM | 0.35 mL | 1.77 mL | 3.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
