Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ethyl Ferulate induces heme oxygenase-1 and protects rat neurons against oxidative stress. |
|---|
| Catalog Num | A14820 |
|---|---|
| Formula | C12H14O4 |
| Molecular Weight | 222.24 |
| CAS Number | 4046-02-0 |
| SMILES | CCOC(=O)C=CC1=CC(=C(C=C1)O)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 39 mg/mL (175.48 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 45 mL | 224.98 mL | 449.96 mL |
| 0.5 mM | 9 mL | 45 mL | 89.99 mL |
| 1 mM | 4.5 mL | 22.5 mL | 45 mL |
| 5 mM | 0.9 mL | 4.5 mL | 9 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
