Signaling Pathway
Antiviral agent
Important Notice: For research use only. We do not sell to patients.
| Discription | Famciclovir(BRL 42810) is a guanine analogue antiviral drug used for the treatment of various herpesvirus infections. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10380 |
|---|---|
| Formula | C14H19N5O4 |
| Molecular Weight | 321.33 |
| CAS Number | 104227-87-4 |
| SMILES | NC1=NC=C2N=CN(CCC(COC(C)=O)COC(C)=O)C2=N1 |
| Synonyms | BRL-42810 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 59 mg/mL (183.6 mM) | |
| Water | 59 mg/mL (183.6 mM) | ||
| Ethanol | 44 mg/mL (136.92 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.12 mL | 155.6 mL | 311.21 mL |
| 0.5 mM | 6.22 mL | 31.12 mL | 62.24 mL |
| 1 mM | 3.11 mL | 15.56 mL | 31.12 mL |
| 5 mM | 0.62 mL | 3.11 mL | 6.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
