Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Forskolin is a cell-permeable diterpenoid that possesses anti-hypertensive, positive inotropic, and adenylyl cyclase activating properties. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12917 |
|---|---|
| Formula | C22H34O7 |
| Molecular Weight | 410.51 |
| CAS Number | 66575-29-9 |
| SMILES | CC(=O)O[C@H]1[C@H]([C@@H]2[C@]([C@H](CCC2(C)C)O)([C@@]3([C@@]1(O[C@@](CC3=O)(C)C=C)C)O)C)O |
| Synonyms | Coleonol, Colforsin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (175.39 mM) | |
| Water | Insoluble | ||
| Ethanol | 33 mg/mL (80.39 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.36 mL | 121.8 mL | 243.6 mL |
| 0.5 mM | 4.87 mL | 24.36 mL | 48.72 mL |
| 1 mM | 2.44 mL | 12.18 mL | 24.36 mL |
| 5 mM | 0.49 mL | 2.44 mL | 4.87 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
