Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | KN-93 Phosphate is a potent and specific inhibitor of Ca2+/calmodulin-dependent protein kinase II (CaMKII) with Ki of 0.37 μM, no remarkable inhibitory effects on APK, PKC, MLCK or Ca2+-PDE activities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14288 |
|---|---|
| Formula | C26H32ClN2O8PS |
| Molecular Weight | 599.03 |
| CAS Number | 1188890-41-6 |
| SMILES | CN(C/C=C/C1=CC=C(C=C1)Cl)CC2=CC=CC=C2N(CCO)S(=O)(=O)C3=CC=C(C=C3)OC.OP(=O)(O)O |
| Synonyms | KN93, KN 93 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (143.56 mM) | |
| Water | 79 mg/mL (131.88 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.69 mL | 83.47 mL | 166.94 mL |
| 0.5 mM | 3.34 mL | 16.69 mL | 33.39 mL |
| 1 mM | 1.67 mL | 8.35 mL | 16.69 mL |
| 5 mM | 0.33 mL | 1.67 mL | 3.34 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
