Loading distributor info...
| Description | Ko 143 is potent and selective inhibitor of breast cancer resistance protein multidrug transporter (BCRP) with an EC90 value of 26 nM. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A11475 |
|---|---|
| Formula | C26H35N3O5 |
| Molecular Weight | 469.59 |
| CAS Number | 461054-93-3 |
| SMILES | O=C1N2[C@@H](CC(C)C)C(NC3=C4C=CC(OC)=C3)=C4C[C@@H]2C(N[C@@H]1CCC(OC(C)(C)C)=O)=O |
| Synonyms | Ko 143,Ko143 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (189.53 mM) | |
| Water | Insoluble | ||
| Ethanol | 89 mg/mL (189.53 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.3 mL | 106.48 mL | 212.95 mL |
| 0.5 mM | 4.26 mL | 21.3 mL | 42.59 mL |
| 1 mM | 2.13 mL | 10.65 mL | 21.3 mL |
| 5 mM | 0.43 mL | 2.13 mL | 4.26 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
