Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LAQ824 (NVP-LAQ824) is a potent novel histone deacetylase inhibitor with significant activity against multiple myeloma. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10516 |
|---|---|
| Formula | C22H25N3O3 |
| Molecular Weight | 379.5 |
| CAS Number | 404951-53-7 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCN(CCO)CC3=CC=C(C=C3)/C=C/C(=O)NO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 66 mg/mL (173.93 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5%DMSO+40%PEG300+5%Tween80+50%ddH2O | 14 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.35 mL | 131.75 mL | 263.5 mL |
| 0.5 mM | 5.27 mL | 26.35 mL | 52.7 mL |
| 1 mM | 2.64 mL | 13.18 mL | 26.35 mL |
| 5 mM | 0.53 mL | 2.64 mL | 5.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
