Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | M344 is a potent inhibitor of HDAC with IC50 of 100 nM and able to induce cell differentiation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11355 |
|---|---|
| Formula | C16H25N3O3 |
| Molecular Weight | 307.39 |
| CAS Number | 251456-60-7 |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)NCCCCCCC(=O)NO |
| Synonyms | Histone Deacetylase Inhibitor III,MS344 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (198.44 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (13.01 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.53 mL | 162.66 mL | 325.32 mL |
| 0.5 mM | 6.51 mL | 32.53 mL | 65.06 mL |
| 1 mM | 3.25 mL | 16.27 mL | 32.53 mL |
| 5 mM | 0.65 mL | 3.25 mL | 6.51 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
