Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Mizoribine is an imidazole nucleoside immunosuppressant agent that was first isolated from the mold Eupenicillium brefeldimium with antibiotic and cytotoxic effects. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10597 |
|---|---|
| Formula | C9H13N3O6 |
| Molecular Weight | 259.22 |
| CAS Number | 50924-49-7 |
| SMILES | C1=NC(=C(N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)O)C(=O)N |
| Synonyms | HE 69 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 1 mg/mL (3.85 mM) | |
| Water | 44 mg/mL (169.74 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.58 mL | 192.89 mL | 385.77 mL |
| 0.5 mM | 7.72 mL | 38.58 mL | 77.15 mL |
| 1 mM | 3.86 mL | 19.29 mL | 38.58 mL |
| 5 mM | 0.77 mL | 3.86 mL | 7.72 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
