Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ML364 is a selective ubiquitin specific peptidase 2 (USP2) inhibitor (IC50=1.1 μM) with anti-proliferative activity. |
|---|
| Catalog Num | A20371 |
|---|---|
| Formula | C24H18F3N3O3S2 |
| Molecular Weight | 517.54 |
| CAS Number | 1991986-30-1 |
| SMILES | O=C(NC1=NC(C2=CC=CC=C2)=CS1)C3=CC=C(C(F)(F)F)C=C3NS(=O)(C4=CC=C(C)C=C4)=O |
| Synonyms | ML 364, ML-364 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (86.95 mM) | |
| Water | Insoluble | ||
| Ethanol | 23 mg/mL (44.44 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.32 mL | 96.61 mL | 193.22 mL |
| 0.5 mM | 3.86 mL | 19.32 mL | 38.64 mL |
| 1 mM | 1.93 mL | 9.66 mL | 19.32 mL |
| 5 mM | 0.39 mL | 1.93 mL | 3.86 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
