Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Moexipril hydrochloride is a potent orally active non-sulfhydryl angiotensin converting enzyme inhibitor (ACE) which is used for the treatment of hypertension and congestive heart failure. |
|---|
| Catalog Num | A11745 |
|---|---|
| Formula | C27H34N2O7.HCl |
| Molecular Weight | 535.03 |
| CAS Number | 82586-52-5 |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N2CC3=CC(=C(C=C3C[C@H]2C(=O)O)OC)OC.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 19 mg/mL (35.51 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.69 mL | 93.45 mL | 186.91 mL |
| 0.5 mM | 3.74 mL | 18.69 mL | 37.38 mL |
| 1 mM | 1.87 mL | 9.35 mL | 18.69 mL |
| 5 mM | 0.37 mL | 1.87 mL | 3.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
