Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Odanacatib is an inhibitor of cathepsin K,an enzyme involved in bone resorption. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11265 |
|---|---|
| Formula | C25H27F4N3O3S |
| Molecular Weight | 525.6 |
| CAS Number | 603139-19-1 |
| SMILES | CC(C)(C[C@@H](C(=O)NC1(CC1)C#N)N[C@@H](C2=CC=C(C=C2)C3=CC=C(C=C3)S(=O)(=O)C)C(F)(F)F)F |
| Synonyms | MK0822 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 96 mg/mL (182.66 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+corn oil | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.03 mL | 95.13 mL | 190.26 mL |
| 0.5 mM | 3.81 mL | 19.03 mL | 38.05 mL |
| 1 mM | 1.9 mL | 9.51 mL | 19.03 mL |
| 5 mM | 0.38 mL | 1.9 mL | 3.81 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
