Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | OSMI-4 is a low nanomolar O-GlcNAc transferase (OGT) inhibitor, with an EC50 of 3 μM in cells. |
|---|
| Catalog Num | A18649 |
|---|---|
| Formula | C27H26ClN3O7S2 |
| Molecular Weight | 604.09 |
| CAS Number | 2260791-14-6 |
| SMILES | O=C1C=CC2=C(C=C(Cl)C(S(N[C@@H](C(N(CC(OCC)=O)CC3=CC=CS3)=O)C4=C(OC)C=CC=C4)(=O)=O)=C2)N1 |
| Synonyms | OSMI4, OSMI 4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (155.6 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.55 mL | 82.77 mL | 165.54 mL |
| 0.5 mM | 3.31 mL | 16.55 mL | 33.11 mL |
| 1 mM | 1.66 mL | 8.28 mL | 16.55 mL |
| 5 mM | 0.33 mL | 1.66 mL | 3.31 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
