Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | OSU-T315 (ILK-IN-1) is a small Integrin-linked kinase (ILK) inhibitor with an IC50 of 0.6 μM, inhibiting PI3K/AKT signaling by dephosphorylation of AKT-Ser473 and other ILK targets (GSK-3β and myosin light chain). |
|---|
| Catalog Num | A20870 |
|---|---|
| Formula | C30H30F3N5O |
| Molecular Weight | 533.59 |
| CAS Number | 2070015-22-2 |
| SMILES | O=C(NC)CCC1=CC(C2=CC=C(C3=CC=C(C(F)(F)F)C=C3)C=C2)=NN1C4=CC=C(N5CCNCC5)C=C4 |
| Synonyms | OSUT315, OSU T315 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (170.53 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 10 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.74 mL | 93.7 mL | 187.41 mL |
| 0.5 mM | 3.75 mL | 18.74 mL | 37.48 mL |
| 1 mM | 1.87 mL | 9.37 mL | 18.74 mL |
| 5 mM | 0.37 mL | 1.87 mL | 3.75 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
