PA-824 (Pretomanid)
Loading distributor info...
Loading distributor info...
| Description | PA-824 is an experimental anti-tuberculosis drug. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
| |||||
| In Vitro | PA-824 (Pretomanid) is a promising nitroimidazole drug with potent activity against Mycobacterium tuberculosis. In vitro, PA-824 demonstrates high efficacy against both drug-sensitive and multidrug-resistant (MDR) strains of M. tuberculosis, with MIC values typically below 1 μg/ml. Its activity spans clinical isolates from diverse geographic regions, including Asia (India and South Korea) and the United States, with MICs ranging between 0.015 and 0.25 μg/ml. [1] A study investigating resistance mechanisms revealed that mutations in PA-824 resistance-associated genes, such as fgd1 (Rv0407) and ddn (Rv3547), do not significantly impact its MICs, suggesting its robustness against certain resistance mutations (MICs ≤ 0.25 μg/ml). [2] Moreover, PA-824 has been shown to exert bactericidal activity under hypoxic conditions, targeting both replicating and non-replicating M. tuberculosis populations. This unique dual-phase activity further emphasizes its potential in treating both active and latent tuberculosis infections. [3] | |||||
| References |
|
| Catalog Num | A11401 |
|---|---|
| Formula | C14H12F3N3O5 |
| Molecular Weight | 359.3 |
| CAS Number | 187235-37-6 |
| SMILES | C1[C@@H](COC2=NC(=CN21)[N+](=O)[O-])OCC3=CC=C(C=C3)OC(F)(F)F |
| Synonyms | PA824 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 64 mg/mL (178.14 mM) | |
| Water | Insoluble | ||
| Ethanol | 14 mg/mL (38.96 mM) | ||
| In vivo | 0.5% methylcellulose | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.83 mL | 139.16 mL | 278.32 mL |
| 0.5 mM | 5.57 mL | 27.83 mL | 55.66 mL |
| 1 mM | 2.78 mL | 13.92 mL | 27.83 mL |
| 5 mM | 0.56 mL | 2.78 mL | 5.57 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2