Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Penicillin V potassium is a broad-spectrum penicillin antibiotic used orally in the treatment of mild to moderate infections by susceptible gram-positive organisms. |
|---|
| Catalog Num | A17915 |
|---|---|
| Formula | C16H17KN2O5S |
| Molecular Weight | 388.48 |
| CAS Number | 132-98-9 |
| SMILES | O=C([C@@H](C(C)(C)S[C@]1([H])[C@@H]2NC(COC3=CC=CC=C3)=O)N1C2=O)[O-].[K+] |
| Synonyms | Penicillin V potassium; Penicillin VK; HSDB 6315; CCRIS 750; CCRIS-750; CCRIS750. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 72 mg/mL (185.33 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.74 mL | 128.71 mL | 257.41 mL |
| 0.5 mM | 5.15 mL | 25.74 mL | 51.48 mL |
| 1 mM | 2.57 mL | 12.87 mL | 25.74 mL |
| 5 mM | 0.51 mL | 2.57 mL | 5.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
