Loading distributor info...
| Description | Pirfenidone is an anti-fibrotic drug for the treatment of idiopathic pulmonary fibrosis (IPF). It works by reducing lung fibrosis through downregulation of the production of growth factors and procollagens I and II. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A16209 |
|---|---|
| Formula | C12H11NO |
| Molecular Weight | 185.22 |
| CAS Number | 53179-13-8 |
| SMILES | O=C1C=CC(C)=CN1C2=CC=CC=C2 |
| Synonyms | AMR69, AMR-69, AMR 69 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 37 mg/mL (199.76 mM) | |
| Water | Insoluble | ||
| Ethanol | 37 mg/mL (199.76 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+ddH2O | 9 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 53.99 mL | 269.95 mL | 539.9 mL |
| 0.5 mM | 10.8 mL | 53.99 mL | 107.98 mL |
| 1 mM | 5.4 mL | 26.99 mL | 53.99 mL |
| 5 mM | 1.08 mL | 5.4 mL | 10.8 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
